About CID 10974275
CID 10974275 (PubChem CID 10974275) has the molecular formula C19H18OP
and a molecular weight of 293.33 g/mol.
Molecular Properties
| Compound Name | CID 10974275 |
| PubChem CID | 10974275 |
| Molecular Formula | C19H18OP |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | — |
| SMILES | COC[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18OP/c1-20-15-16-9-8-14-19(16)21(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-14H,15H2,1H3 |
| InChIKey | WTKMNQVMUWADOS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 10974275 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10974275?
The IUPAC name of CID 10974275 (CID 10974275) is not available.
What is the SMILES notation for CID 10974275?
The canonical SMILES for CID 10974275 is COC[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 10974275?
The InChIKey is WTKMNQVMUWADOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18OP/c1-20-15-16-9-8-14-19(16)21(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-14H,15H2,1H3.
What are the key properties of CID 10974275?
CID 10974275 has a molecular weight of 293.33 g/mol, XLogP of 3.50, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10974275 is sourced from PubChem (CID 10974275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).