About CID 11239431
CID 11239431 (PubChem CID 11239431) has the molecular formula C42H44FeO2P2+2
and a molecular weight of 698.61 g/mol.
Molecular Properties
| Compound Name | CID 11239431 |
| PubChem CID | 11239431 |
| Molecular Formula | C42H44FeO2P2+2 |
| Molecular Weight | 698.61 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | — |
| SMILES | COC(C)(C)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1.COC(C)(C)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1.[Fe+2] |
| InChI | InChI=1S/2C21H22OP.Fe/c2*1-21(2,22-3)19-15-10-16-20(19)23(17-11-6-4-7-12-17)18-13-8-5-9-14-18;/h2*4-16H,1-3H3;/q;;+2 |
| InChIKey | YLOTWVVYFICZJO-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 698.61 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 11239431 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11239431?
The IUPAC name of CID 11239431 (CID 11239431) is not available.
What is the SMILES notation for CID 11239431?
The canonical SMILES for CID 11239431 is COC(C)(C)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1.COC(C)(C)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1.[Fe+2].
What is the InChIKey of CID 11239431?
The InChIKey is YLOTWVVYFICZJO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C21H22OP.Fe/c2*1-21(2,22-3)19-15-10-16-20(19)23(17-11-6-4-7-12-17)18-13-8-5-9-14-18;/h2*4-16H,1-3H3;/q;;+2.
What are the key properties of CID 11239431?
CID 11239431 has a molecular weight of 698.61 g/mol, XLogP of 8.55, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11239431 is sourced from PubChem (CID 11239431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).