C40H56O5SSi2 — CID 10974542
2-[(2R,4R,5S,6R)-4-(benzenesulfonyl)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-methyl-1,3-dioxan-2-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 10974542) has the molecular formula C40H56O5SSi2 and a molecular weight of 705.12 g/mol. Its IUPAC name is 2-[(2R,4R,5S,6R)-4-(benzenesulfonyl)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-methyl-1,3-dioxan-2-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[(2R,4R,5S,6R)-4-(benzenesulfonyl)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-methyl-1,3-dioxan-2-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10974542 |
| Molecular Formula | C40H56O5SSi2 |
| Molecular Weight | 705.12 g/mol |
| Exact Mass | 704.34 |
| IUPAC Name | 2-[(2R,4R,5S,6R)-4-(benzenesulfonyl)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-methyl-1,3-dioxan-2-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#C[C@@H]1O[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)[C@@H](S(=O)(=O)c2ccccc2)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H56O5SSi2/c1-30(2)47(31(3)4,32(5)6)29-27-38-44-37(33(7)39(45-38)46(41,42)34-20-14-11-15-21-34)26-28-43-48(40(8,9)10,35-22-16-12-17-23-35)36-24-18-13-19-25-36/h11-25,30-33,37-39H,26,28H2,1-10H3/t33-,37+,38+,39+/m0/s1 |
| InChIKey | WNFUBDKFXFWPLS-XVTDRTOASA-N |
| XLogP | 8.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.12 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|