C56H42N4O2 — CID 10974819
[8-[15-[8-(hydroxymethyl)naphthalen-1-yl]-10,20-bis(4-methylphenyl)-21,24-dihydroporphyrin-5-yl]naphthalen-1-yl]methanol (PubChem CID 10974819) has the molecular formula C56H42N4O2 and a molecular weight of 802.98 g/mol. Its IUPAC name is [8-[15-[8-(hydroxymethyl)naphthalen-1-yl]-10,20-bis(4-methylphenyl)-21,24-dihydroporphyrin-5-yl]naphthalen-1-yl]methanol.
| Compound Name | [8-[15-[8-(hydroxymethyl)naphthalen-1-yl]-10,20-bis(4-methylphenyl)-21,24-dihydroporphyrin-5-yl]naphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 10974819 |
| Molecular Formula | C56H42N4O2 |
| Molecular Weight | 802.98 g/mol |
| Exact Mass | 802.33 |
| IUPAC Name | [8-[15-[8-(hydroxymethyl)naphthalen-1-yl]-10,20-bis(4-methylphenyl)-21,24-dihydroporphyrin-5-yl]naphthalen-1-yl]methanol |
| SMILES | Cc1ccc(-c2c3nc(c(-c4cccc5cccc(CO)c45)c4ccc([nH]4)c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4cccc5cccc(CO)c45)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C56H42N4O2/c1-33-15-19-37(20-16-33)53-43-23-27-47(57-43)55(41-13-5-9-35-7-3-11-39(31-61)51(35)41)49-29-25-45(59-49)54(38-21-17-34(2)18-22-38)46-26-30-50(60-46)56(48-28-24-44(53)58-48)42-14-6-10-36-8-4-12-40(32-62)52(36)42/h3-30,57-58,61-62H,31-32H2,1-2H3/b53-43-,53-44-,54-45-,54-46-,55-47-,55-49-,56-48-,56-50- |
| InChIKey | QKHOLECOTMYCLX-YNJAONIJSA-N |
| XLogP | 13.23 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.98 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |