C68H61Cl8N4Rh — CID 10975338
ethylbenzene;rhodium(3+);5,10,15,20-tetrakis(4-tert-butylphenyl)-2,3,7,8,12,13,17,18-octachloroporphyrin-22,24-diide (PubChem CID 10975338) has the molecular formula C68H61Cl8N4Rh and a molecular weight of 1320.79 g/mol. Its IUPAC name is ethylbenzene;rhodium(3+);5,10,15,20-tetrakis(4-tert-butylphenyl)-2,3,7,8,12,13,17,18-octachloroporphyrin-22,24-diide.
| Compound Name | ethylbenzene;rhodium(3+);5,10,15,20-tetrakis(4-tert-butylphenyl)-2,3,7,8,12,13,17,18-octachloroporphyrin-22,24-diide |
|---|---|
| PubChem CID | 10975338 |
| Molecular Formula | C68H61Cl8N4Rh |
| Molecular Weight | 1320.79 g/mol |
| Exact Mass | 1316.15 |
| IUPAC Name | ethylbenzene;rhodium(3+);5,10,15,20-tetrakis(4-tert-butylphenyl)-2,3,7,8,12,13,17,18-octachloroporphyrin-22,24-diide |
| SMILES | CC(C)(C)c1ccc(-c2c3nc(c(-c4ccc(C(C)(C)C)cc4)c4[n-]c(c(Cl)c4Cl)c(-c4ccc(C(C)(C)C)cc4)c4nc(c(-c5ccc(C(C)(C)C)cc5)c5[n-]c2c(Cl)c5Cl)C(Cl)=C4Cl)C(Cl)=C3Cl)cc1.[CH2-]Cc1ccccc1.[Rh+3] |
| InChI | InChI=1S/C60H52Cl8N4.C8H9.Rh/c1-57(2,3)33-21-13-29(14-22-33)37-49-41(61)43(63)51(69-49)38(30-15-23-34(24-16-30)58(4,5)6)53-45(65)47(67)55(71-53)40(32-19-27-36(28-20-32)60(10,11)12)56-48(68)46(66)54(72-56)39(52-44(64)42(62)50(37)70-52)31-17-25-35(26-18-31)59(7,8)9;1-2-8-6-4-3-5-7-8;/h13-28H,1-12H3;3-7H,1-2H2;/q-2;-1;+3/b49-37-,50-37-,51-38-,52-39-,53-38-,54-39-,55-40-,56-40-;; |
| InChIKey | WNVSMAFCWWKDCK-YXERZAKESA-N |
| XLogP | 22.71 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1320.79 |
| LogP ≤ 5 | 22.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|