C16H28O3Si — CID 10979375
cis-methyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-prop-2-enylcyclopropane-1-carboxylate (PubChem CID 10979375) has the molecular formula C16H28O3Si and a molecular weight of 296.48 g/mol. Its IUPAC name is cis-methyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-prop-2-enylcyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-prop-2-enylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 10979375 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | cis-methyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-prop-2-enylcyclopropane-1-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)C[C@]1(C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O3Si/c1-9-11-15(13(17)18-6)12-16(15,10-2)19-20(7,8)14(3,4)5/h9-10H,1-2,11-12H2,3-8H3/t15-,16+/m1/s1 |
| InChIKey | DCJAWVHDAHPRDY-CVEARBPZSA-N |
| XLogP | 4.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|