C20H27NO2S2 — CID 10981727
(2R,3R)-2-hex-1-ynyl-1-(4-methylphenyl)sulfonyl-3-(1-methylsulfanylethenyl)pyrrolidine (PubChem CID 10981727) has the molecular formula C20H27NO2S2 and a molecular weight of 377.58 g/mol. Its IUPAC name is (2R,3R)-2-hex-1-ynyl-1-(4-methylphenyl)sulfonyl-3-(1-methylsulfanylethenyl)pyrrolidine.
| Compound Name | (2R,3R)-2-hex-1-ynyl-1-(4-methylphenyl)sulfonyl-3-(1-methylsulfanylethenyl)pyrrolidine |
|---|---|
| PubChem CID | 10981727 |
| Molecular Formula | C20H27NO2S2 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (2R,3R)-2-hex-1-ynyl-1-(4-methylphenyl)sulfonyl-3-(1-methylsulfanylethenyl)pyrrolidine |
| SMILES | C=C(SC)[C@@H]1CCN(S(=O)(=O)c2ccc(C)cc2)[C@H]1C#CCCCC |
| InChI | InChI=1S/C20H27NO2S2/c1-5-6-7-8-9-20-19(17(3)24-4)14-15-21(20)25(22,23)18-12-10-16(2)11-13-18/h10-13,19-20H,3,5-7,14-15H2,1-2,4H3/t19-,20-/m0/s1 |
| InChIKey | YFFVYQSRWYKCCK-PMACEKPBSA-N |
| XLogP | 4.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|