C20H39NO10 — CID 10983294
(2R,3S,4S,5R,6R)-2-[(2-ethylhexylamino)methyl]-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol (PubChem CID 10983294) has the molecular formula C20H39NO10 and a molecular weight of 453.53 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-[(2-ethylhexylamino)methyl]-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-[(2-ethylhexylamino)methyl]-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 10983294 |
| Molecular Formula | C20H39NO10 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-[(2-ethylhexylamino)methyl]-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol |
| SMILES | CCCCC(CC)CNC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H39NO10/c1-3-5-6-10(4-2)7-21-8-11-13(23)15(25)17(27)19(29-11)31-20-18(28)16(26)14(24)12(9-22)30-20/h10-28H,3-9H2,1-2H3/t10?,11-,12-,13-,14-,15+,16+,17-,18-,19-,20-/m1/s1 |
| InChIKey | XDOLMXIOSVFPSW-SWRVSKMJSA-N |
| XLogP | -2.58 |
| TPSA | 181.33 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |