C24H22N4O4S — CID 10983433
[14-[2-(dimethylamino)ethyl]-8-oxo-5,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl] 4-methylbenzenesulfonate (PubChem CID 10983433) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is [14-[2-(dimethylamino)ethyl]-8-oxo-5,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl] 4-methylbenzenesulfonate.
| Compound Name | [14-[2-(dimethylamino)ethyl]-8-oxo-5,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10983433 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | [14-[2-(dimethylamino)ethyl]-8-oxo-5,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3c4c(nn3CCN(C)C)-c3ccncc3C(=O)c24)cc1 |
| InChI | InChI=1S/C24H22N4O4S/c1-15-4-6-16(7-5-15)33(30,31)32-20-9-8-19-21-22(20)24(29)18-14-25-11-10-17(18)23(21)26-28(19)13-12-27(2)3/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | MVMSMOMRNLXEMN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|