C23H26O7S2 — CID 10983647
[4-[(2R,3R)-3-acetyloxy-2-[(4-methylphenyl)sulfonyl-methylsulfanylmethyl]butanoyl]phenyl] acetate (PubChem CID 10983647) has the molecular formula C23H26O7S2 and a molecular weight of 478.59 g/mol. Its IUPAC name is [4-[(2R,3R)-3-acetyloxy-2-[(4-methylphenyl)sulfonyl-methylsulfanylmethyl]butanoyl]phenyl] acetate.
| Compound Name | [4-[(2R,3R)-3-acetyloxy-2-[(4-methylphenyl)sulfonyl-methylsulfanylmethyl]butanoyl]phenyl] acetate |
|---|---|
| PubChem CID | 10983647 |
| Molecular Formula | C23H26O7S2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | [4-[(2R,3R)-3-acetyloxy-2-[(4-methylphenyl)sulfonyl-methylsulfanylmethyl]butanoyl]phenyl] acetate |
| SMILES | CSC([C@@H](C(=O)c1ccc(OC(C)=O)cc1)[C@@H](C)OC(C)=O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H26O7S2/c1-14-6-12-20(13-7-14)32(27,28)23(31-5)21(15(2)29-16(3)24)22(26)18-8-10-19(11-9-18)30-17(4)25/h6-13,15,21,23H,1-5H3/t15-,21-,23?/m1/s1 |
| InChIKey | MKTQWNRHAOFBLF-FLSDUMPPSA-N |
| XLogP | 3.83 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|