C33H41NO9 — CID 10984828
benzyl 2-[(2S)-2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxy-3-(3-prop-2-enoxycarbonyloxyphenyl)propanoate (PubChem CID 10984828) has the molecular formula C33H41NO9 and a molecular weight of 595.69 g/mol. Its IUPAC name is benzyl 2-[(2S)-2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxy-3-(3-prop-2-enoxycarbonyloxyphenyl)propanoate.
| Compound Name | benzyl 2-[(2S)-2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxy-3-(3-prop-2-enoxycarbonyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 10984828 |
| Molecular Formula | C33H41NO9 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | benzyl 2-[(2S)-2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxy-3-(3-prop-2-enoxycarbonyloxyphenyl)propanoate |
| SMILES | C=CCOC(=O)Oc1cccc(CC(OC(=O)[C@@H](NC(=O)OC(C)(C)C)C2CCCCC2)C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C33H41NO9/c1-5-19-39-32(38)41-26-18-12-15-24(20-26)21-27(29(35)40-22-23-13-8-6-9-14-23)42-30(36)28(25-16-10-7-11-17-25)34-31(37)43-33(2,3)4/h5-6,8-9,12-15,18,20,25,27-28H,1,7,10-11,16-17,19,21-22H2,2-4H3,(H,34,37)/t27?,28-/m0/s1 |
| InChIKey | IZYUEOFJIAIXEF-CPRJBALCSA-N |
| XLogP | 6.06 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|