C28H25Br2NO3S2 — CID 10985129
ethyl 2-[2-(4-bromobenzoyl)-5-[(4-methylphenyl)methylsulfanyl]-4-pyridin-1-ium-1-ylthiophen-3-yl]acetate bromide (PubChem CID 10985129) has the molecular formula C28H25Br2NO3S2 and a molecular weight of 647.45 g/mol. Its IUPAC name is ethyl 2-[2-(4-bromobenzoyl)-5-[(4-methylphenyl)methylsulfanyl]-4-pyridin-1-ium-1-ylthiophen-3-yl]acetate bromide.
| Compound Name | ethyl 2-[2-(4-bromobenzoyl)-5-[(4-methylphenyl)methylsulfanyl]-4-pyridin-1-ium-1-ylthiophen-3-yl]acetate bromide |
|---|---|
| PubChem CID | 10985129 |
| Molecular Formula | C28H25Br2NO3S2 |
| Molecular Weight | 647.45 g/mol |
| Exact Mass | 644.96 |
| IUPAC Name | ethyl 2-[2-(4-bromobenzoyl)-5-[(4-methylphenyl)methylsulfanyl]-4-pyridin-1-ium-1-ylthiophen-3-yl]acetate bromide |
| SMILES | CCOC(=O)Cc1c(C(=O)c2ccc(Br)cc2)sc(SCc2ccc(C)cc2)c1-[n+]1ccccc1.[Br-] |
| InChI | InChI=1S/C28H25BrNO3S2.BrH/c1-3-33-24(31)17-23-25(30-15-5-4-6-16-30)28(34-18-20-9-7-19(2)8-10-20)35-27(23)26(32)21-11-13-22(29)14-12-21;/h4-16H,3,17-18H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | SQEUKJPPCAILHR-UHFFFAOYSA-M |
| XLogP | 3.73 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|