C28H26NO3S2+ — CID 15535011
ethyl 2-[2-benzoyl-5-benzylsulfanyl-4-(4-methylpyridin-1-ium-1-yl)thiophen-3-yl]acetate (PubChem CID 15535011) has the molecular formula C28H26NO3S2+ and a molecular weight of 488.65 g/mol. Its IUPAC name is ethyl 2-[2-benzoyl-5-benzylsulfanyl-4-(4-methylpyridin-1-ium-1-yl)thiophen-3-yl]acetate.
| Compound Name | ethyl 2-[2-benzoyl-5-benzylsulfanyl-4-(4-methylpyridin-1-ium-1-yl)thiophen-3-yl]acetate |
|---|---|
| PubChem CID | 15535011 |
| Molecular Formula | C28H26NO3S2+ |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | ethyl 2-[2-benzoyl-5-benzylsulfanyl-4-(4-methylpyridin-1-ium-1-yl)thiophen-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C(=O)c2ccccc2)sc(SCc2ccccc2)c1-[n+]1ccc(C)cc1 |
| InChI | InChI=1S/C28H26NO3S2/c1-3-32-24(30)18-23-25(29-16-14-20(2)15-17-29)28(33-19-21-10-6-4-7-11-21)34-27(23)26(31)22-12-8-5-9-13-22/h4-17H,3,18-19H2,1-2H3/q+1 |
| InChIKey | DCVIYSRGPJWTEN-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|