C24H24INO3S2 — CID 11657023
ethyl 2-[2-benzoyl-4-(4-methylpyridin-1-ium-1-yl)-5-prop-2-enylsulfanylthiophen-3-yl]acetate iodide (PubChem CID 11657023) has the molecular formula C24H24INO3S2 and a molecular weight of 565.50 g/mol. Its IUPAC name is ethyl 2-[2-benzoyl-4-(4-methylpyridin-1-ium-1-yl)-5-prop-2-enylsulfanylthiophen-3-yl]acetate iodide.
| Compound Name | ethyl 2-[2-benzoyl-4-(4-methylpyridin-1-ium-1-yl)-5-prop-2-enylsulfanylthiophen-3-yl]acetate iodide |
|---|---|
| PubChem CID | 11657023 |
| Molecular Formula | C24H24INO3S2 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 565.02 |
| IUPAC Name | ethyl 2-[2-benzoyl-4-(4-methylpyridin-1-ium-1-yl)-5-prop-2-enylsulfanylthiophen-3-yl]acetate iodide |
| SMILES | C=CCSc1sc(C(=O)c2ccccc2)c(CC(=O)OCC)c1-[n+]1ccc(C)cc1.[I-] |
| InChI | InChI=1S/C24H24NO3S2.HI/c1-4-15-29-24-21(25-13-11-17(3)12-14-25)19(16-20(26)28-5-2)23(30-24)22(27)18-9-7-6-8-10-18;/h4,6-14H,1,5,15-16H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | NULFZBUMDDCIFH-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|