C30H27ClINO3S2 — CID 11664720
ethyl 2-[2-(4-chlorobenzoyl)-4-(4-methylpyridin-1-ium-1-yl)-5-[(E)-3-phenylprop-2-enyl]sulfanylthiophen-3-yl]acetate iodide (PubChem CID 11664720) has the molecular formula C30H27ClINO3S2 and a molecular weight of 676.04 g/mol. Its IUPAC name is ethyl 2-[2-(4-chlorobenzoyl)-4-(4-methylpyridin-1-ium-1-yl)-5-[(E)-3-phenylprop-2-enyl]sulfanylthiophen-3-yl]acetate iodide.
| Compound Name | ethyl 2-[2-(4-chlorobenzoyl)-4-(4-methylpyridin-1-ium-1-yl)-5-[(E)-3-phenylprop-2-enyl]sulfanylthiophen-3-yl]acetate iodide |
|---|---|
| PubChem CID | 11664720 |
| Molecular Formula | C30H27ClINO3S2 |
| Molecular Weight | 676.04 g/mol |
| Exact Mass | 675.02 |
| IUPAC Name | ethyl 2-[2-(4-chlorobenzoyl)-4-(4-methylpyridin-1-ium-1-yl)-5-[(E)-3-phenylprop-2-enyl]sulfanylthiophen-3-yl]acetate iodide |
| SMILES | CCOC(=O)Cc1c(C(=O)c2ccc(Cl)cc2)sc(SC/C=C/c2ccccc2)c1-[n+]1ccc(C)cc1.[I-] |
| InChI | InChI=1S/C30H27ClNO3S2.HI/c1-3-35-26(33)20-25-27(32-17-15-21(2)16-18-32)30(36-19-7-10-22-8-5-4-6-9-22)37-29(25)28(34)23-11-13-24(31)14-12-23;/h4-18H,3,19-20H2,1-2H3;1H/q+1;/p-1/b10-7+; |
| InChIKey | VCKSCSKCQLBFLT-HCUGZAAXSA-M |
| XLogP | 4.13 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.04 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|