C25H25ClNO3S2+ — CID 11498159
ethyl 2-[5-[(E)-but-2-enyl]sulfanyl-2-(4-chlorobenzoyl)-4-(4-methylpyridin-1-ium-1-yl)thiophen-3-yl]acetate (PubChem CID 11498159) has the molecular formula C25H25ClNO3S2+ and a molecular weight of 487.07 g/mol. Its IUPAC name is ethyl 2-[5-[(E)-but-2-enyl]sulfanyl-2-(4-chlorobenzoyl)-4-(4-methylpyridin-1-ium-1-yl)thiophen-3-yl]acetate.
| Compound Name | ethyl 2-[5-[(E)-but-2-enyl]sulfanyl-2-(4-chlorobenzoyl)-4-(4-methylpyridin-1-ium-1-yl)thiophen-3-yl]acetate |
|---|---|
| PubChem CID | 11498159 |
| Molecular Formula | C25H25ClNO3S2+ |
| Molecular Weight | 487.07 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | ethyl 2-[5-[(E)-but-2-enyl]sulfanyl-2-(4-chlorobenzoyl)-4-(4-methylpyridin-1-ium-1-yl)thiophen-3-yl]acetate |
| SMILES | C/C=C/CSc1sc(C(=O)c2ccc(Cl)cc2)c(CC(=O)OCC)c1-[n+]1ccc(C)cc1 |
| InChI | InChI=1S/C25H25ClNO3S2/c1-4-6-15-31-25-22(27-13-11-17(3)12-14-27)20(16-21(28)30-5-2)24(32-25)23(29)18-7-9-19(26)10-8-18/h4,6-14H,5,15-16H2,1-3H3/q+1/b6-4+ |
| InChIKey | UZNYKZBBLFHLDQ-GQCTYLIASA-N |
| XLogP | 5.99 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.07 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|