C22H21BrNO3S2+ — CID 44604497
ethyl 2-[2-(4-bromobenzoyl)-4-(3,5-dimethylpyridin-1-ium-1-yl)-5-sulfanylthiophen-3-yl]acetate (PubChem CID 44604497) has the molecular formula C22H21BrNO3S2+ and a molecular weight of 491.45 g/mol. Its IUPAC name is ethyl 2-[2-(4-bromobenzoyl)-4-(3,5-dimethylpyridin-1-ium-1-yl)-5-sulfanylthiophen-3-yl]acetate.
| Compound Name | ethyl 2-[2-(4-bromobenzoyl)-4-(3,5-dimethylpyridin-1-ium-1-yl)-5-sulfanylthiophen-3-yl]acetate |
|---|---|
| PubChem CID | 44604497 |
| Molecular Formula | C22H21BrNO3S2+ |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | ethyl 2-[2-(4-bromobenzoyl)-4-(3,5-dimethylpyridin-1-ium-1-yl)-5-sulfanylthiophen-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C(=O)c2ccc(Br)cc2)sc(S)c1-[n+]1cc(C)cc(C)c1 |
| InChI | InChI=1S/C22H20BrNO3S2/c1-4-27-18(25)10-17-19(24-11-13(2)9-14(3)12-24)22(28)29-21(17)20(26)15-5-7-16(23)8-6-15/h5-9,11-12H,4,10H2,1-3H3/p+1 |
| InChIKey | GTHPIQALCAVBQI-UHFFFAOYSA-O |
| XLogP | 5.03 |
| TPSA | 47.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|