C35H70O5Si3 — CID 10985171
2-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-trimethylsilyloxycyclopenten-1-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 10985171) has the molecular formula C35H70O5Si3 and a molecular weight of 655.20 g/mol. Its IUPAC name is 2-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-trimethylsilyloxycyclopenten-1-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-trimethylsilyloxycyclopenten-1-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10985171 |
| Molecular Formula | C35H70O5Si3 |
| Molecular Weight | 655.20 g/mol |
| Exact Mass | 654.45 |
| IUPAC Name | 2-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-trimethylsilyloxycyclopenten-1-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1C(CCOC(=O)C(C)(C)C)=C(O[Si](C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H70O5Si3/c1-18-19-20-21-27(38-42(14,15)34(5,6)7)22-23-28-29(24-25-37-32(36)33(2,3)4)30(39-41(11,12)13)26-31(28)40-43(16,17)35(8,9)10/h22-23,27-28,31H,18-21,24-26H2,1-17H3/b23-22+/t27-,28+,31+/m0/s1 |
| InChIKey | AEODAYGSNFRLIF-MSSDDAISSA-N |
| XLogP | 11.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.20 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|