C13H17N2O3+ — CID 10988637
(E)-2-hydroxy-2-[(2R,4R)-4-phenoxypentan-2-yl]oxyethenediazonium (PubChem CID 10988637) has the molecular formula C13H17N2O3+ and a molecular weight of 249.29 g/mol. Its IUPAC name is (E)-2-hydroxy-2-[(2R,4R)-4-phenoxypentan-2-yl]oxyethenediazonium.
| Compound Name | (E)-2-hydroxy-2-[(2R,4R)-4-phenoxypentan-2-yl]oxyethenediazonium |
|---|---|
| PubChem CID | 10988637 |
| Molecular Formula | C13H17N2O3+ |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (E)-2-hydroxy-2-[(2R,4R)-4-phenoxypentan-2-yl]oxyethenediazonium |
| SMILES | C[C@H](C[C@@H](C)Oc1ccccc1)O/C(O)=C/[N+]#N |
| InChI | InChI=1S/C13H16N2O3/c1-10(17-12-6-4-3-5-7-12)8-11(2)18-13(16)9-15-14/h3-7,9-11H,8H2,1-2H3/p+1/b13-9+/t10-,11-/m1/s1 |
| InChIKey | YZVCIMBCYTZSCL-IXBWVPESSA-O |
| XLogP | 3.46 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|