C11H15N3O6S — CID 10990740
[(1S,3S,4R)-1-(2,4-dioxopyrimidin-1-yl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-yl]methyl methanesulfonate (PubChem CID 10990740) has the molecular formula C11H15N3O6S and a molecular weight of 317.32 g/mol. Its IUPAC name is [(1S,3S,4R)-1-(2,4-dioxopyrimidin-1-yl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-yl]methyl methanesulfonate.
| Compound Name | [(1S,3S,4R)-1-(2,4-dioxopyrimidin-1-yl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10990740 |
| Molecular Formula | C11H15N3O6S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | [(1S,3S,4R)-1-(2,4-dioxopyrimidin-1-yl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1O[C@]2(n3ccc(=O)[nH]c3=O)CN[C@@H]1C2 |
| InChI | InChI=1S/C11H15N3O6S/c1-21(17,18)19-5-8-7-4-11(20-8,6-12-7)14-3-2-9(15)13-10(14)16/h2-3,7-8,12H,4-6H2,1H3,(H,13,15,16)/t7-,8-,11+/m1/s1 |
| InChIKey | SMKZAOQRKJEYFT-XLDPMVHQSA-N |
| XLogP | -2.07 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|