C22H22O2S — CID 10991725
(1R,6R,7R)-7-phenylmethoxy-3-phenylsulfanyl-10-oxabicyclo[4.3.1]deca-2,8-diene (PubChem CID 10991725) has the molecular formula C22H22O2S and a molecular weight of 350.48 g/mol. Its IUPAC name is (1R,6R,7R)-7-phenylmethoxy-3-phenylsulfanyl-10-oxabicyclo[4.3.1]deca-2,8-diene.
| Compound Name | (1R,6R,7R)-7-phenylmethoxy-3-phenylsulfanyl-10-oxabicyclo[4.3.1]deca-2,8-diene |
|---|---|
| PubChem CID | 10991725 |
| Molecular Formula | C22H22O2S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (1R,6R,7R)-7-phenylmethoxy-3-phenylsulfanyl-10-oxabicyclo[4.3.1]deca-2,8-diene |
| SMILES | C1=C[C@@H](OCc2ccccc2)[C@H]2CCC(Sc3ccccc3)=C[C@@H]1O2 |
| InChI | InChI=1S/C22H22O2S/c1-3-7-17(8-4-1)16-23-21-13-11-18-15-20(12-14-22(21)24-18)25-19-9-5-2-6-10-19/h1-11,13,15,18,21-22H,12,14,16H2/t18-,21-,22-/m1/s1 |
| InChIKey | CWPQJNVVRISGIO-STZQEDGTSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|