C31H40O2SSi — CID 10994756
tert-butyl-[3-[(2S,3R,5R)-2,5-dimethyl-3-phenylsulfanyloxolan-2-yl]propoxy]-diphenylsilane (PubChem CID 10994756) has the molecular formula C31H40O2SSi and a molecular weight of 504.81 g/mol. Its IUPAC name is tert-butyl-[3-[(2S,3R,5R)-2,5-dimethyl-3-phenylsulfanyloxolan-2-yl]propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[3-[(2S,3R,5R)-2,5-dimethyl-3-phenylsulfanyloxolan-2-yl]propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10994756 |
| Molecular Formula | C31H40O2SSi |
| Molecular Weight | 504.81 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | tert-butyl-[3-[(2S,3R,5R)-2,5-dimethyl-3-phenylsulfanyloxolan-2-yl]propoxy]-diphenylsilane |
| SMILES | C[C@@H]1C[C@@H](Sc2ccccc2)[C@](C)(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C31H40O2SSi/c1-25-24-29(34-26-16-9-6-10-17-26)31(5,33-25)22-15-23-32-35(30(2,3)4,27-18-11-7-12-19-27)28-20-13-8-14-21-28/h6-14,16-21,25,29H,15,22-24H2,1-5H3/t25-,29-,31+/m1/s1 |
| InChIKey | UMXLVDSHUGRDAH-ICTSCBFQSA-N |
| XLogP | 7.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.81 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|