C35H44N2O3Si — CID 10995377
(4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-ethyl-4-formyl-N-[2-(1H-indol-3-yl)ethyl]hexanamide (PubChem CID 10995377) has the molecular formula C35H44N2O3Si and a molecular weight of 568.83 g/mol. Its IUPAC name is (4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-ethyl-4-formyl-N-[2-(1H-indol-3-yl)ethyl]hexanamide.
| Compound Name | (4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-ethyl-4-formyl-N-[2-(1H-indol-3-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 10995377 |
| Molecular Formula | C35H44N2O3Si |
| Molecular Weight | 568.83 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | (4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-ethyl-4-formyl-N-[2-(1H-indol-3-yl)ethyl]hexanamide |
| SMILES | CC[C@@](C=O)(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CCC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C35H44N2O3Si/c1-5-35(27-38,22-20-33(39)36-24-21-28-26-37-32-19-13-12-18-31(28)32)23-25-40-41(34(2,3)4,29-14-8-6-9-15-29)30-16-10-7-11-17-30/h6-19,26-27,37H,5,20-25H2,1-4H3,(H,36,39)/t35-/m0/s1 |
| InChIKey | JRRABNJBUFULSO-DHUJRADRSA-N |
| XLogP | 6.17 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.83 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|