C31H62O6Si2 — CID 10995508
methyl (E,5R,6S,7R)-7-[(4S,5S,6R)-6-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-methyl-2,2-di(propan-2-yl)-1,3,2-dioxasilinan-4-yl]-4-ethyl-6-hydroxy-5-methyloct-3-enoate (PubChem CID 10995508) has the molecular formula C31H62O6Si2 and a molecular weight of 587.00 g/mol. Its IUPAC name is methyl (E,5R,6S,7R)-7-[(4S,5S,6R)-6-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-methyl-2,2-di(propan-2-yl)-1,3,2-dioxasilinan-4-yl]-4-ethyl-6-hydroxy-5-methyloct-3-enoate.
| Compound Name | methyl (E,5R,6S,7R)-7-[(4S,5S,6R)-6-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-methyl-2,2-di(propan-2-yl)-1,3,2-dioxasilinan-4-yl]-4-ethyl-6-hydroxy-5-methyloct-3-enoate |
|---|---|
| PubChem CID | 10995508 |
| Molecular Formula | C31H62O6Si2 |
| Molecular Weight | 587.00 g/mol |
| Exact Mass | 586.41 |
| IUPAC Name | methyl (E,5R,6S,7R)-7-[(4S,5S,6R)-6-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-5-methyl-2,2-di(propan-2-yl)-1,3,2-dioxasilinan-4-yl]-4-ethyl-6-hydroxy-5-methyloct-3-enoate |
| SMILES | CC/C(=C\CC(=O)OC)[C@@H](C)[C@H](O)[C@@H](C)[C@@H]1O[Si](C(C)C)(C(C)C)O[C@H]([C@@H](C)CO[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C31H62O6Si2/c1-16-26(17-18-27(32)34-13)23(7)28(33)24(8)30-25(9)29(36-39(37-30,20(2)3)21(4)5)22(6)19-35-38(14,15)31(10,11)12/h17,20-25,28-30,33H,16,18-19H2,1-15H3/b26-17+/t22-,23+,24+,25-,28-,29+,30-/m0/s1 |
| InChIKey | NMDYNTKPWUVWBN-MWOYJCDESA-N |
| XLogP | 7.86 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.00 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|