C40H53NO4Si2 — CID 10995981
[(2R,3S,4S,5S,6R)-3,5-dimethyl-2-[(E)-1-(2-methyl-1,3-oxazol-4-yl)prop-1-en-2-yl]-6-(2-triethylsilyloxyethyl)oxan-4-yl]oxy-triphenylsilane (PubChem CID 10995981) has the molecular formula C40H53NO4Si2 and a molecular weight of 668.04 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-3,5-dimethyl-2-[(E)-1-(2-methyl-1,3-oxazol-4-yl)prop-1-en-2-yl]-6-(2-triethylsilyloxyethyl)oxan-4-yl]oxy-triphenylsilane.
| Compound Name | [(2R,3S,4S,5S,6R)-3,5-dimethyl-2-[(E)-1-(2-methyl-1,3-oxazol-4-yl)prop-1-en-2-yl]-6-(2-triethylsilyloxyethyl)oxan-4-yl]oxy-triphenylsilane |
|---|---|
| PubChem CID | 10995981 |
| Molecular Formula | C40H53NO4Si2 |
| Molecular Weight | 668.04 g/mol |
| Exact Mass | 667.35 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-3,5-dimethyl-2-[(E)-1-(2-methyl-1,3-oxazol-4-yl)prop-1-en-2-yl]-6-(2-triethylsilyloxyethyl)oxan-4-yl]oxy-triphenylsilane |
| SMILES | CC[Si](CC)(CC)OCC[C@H]1O[C@@H](/C(C)=C/c2coc(C)n2)[C@H](C)[C@@H](O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C40H53NO4Si2/c1-8-46(9-2,10-3)43-27-26-38-31(5)40(32(6)39(44-38)30(4)28-34-29-42-33(7)41-34)45-47(35-20-14-11-15-21-35,36-22-16-12-17-23-36)37-24-18-13-19-25-37/h11-25,28-29,31-32,38-40H,8-10,26-27H2,1-7H3/b30-28+/t31-,32-,38+,39-,40-/m0/s1 |
| InChIKey | BWZGJRPIZJFYKF-TWVNKXILSA-N |
| XLogP | 7.89 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.04 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|