C40H58NO9P — CID 10996201
[(2R,3S,4S,5R,6R)-6-octoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 10996201) has the molecular formula C40H58NO9P and a molecular weight of 727.88 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-octoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-octoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 10996201 |
| Molecular Formula | C40H58NO9P |
| Molecular Weight | 727.88 g/mol |
| Exact Mass | 727.38 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-octoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](COP(=O)([O-])OCC[N+](C)(C)C)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H58NO9P/c1-5-6-7-8-9-19-27-44-40-39(47-31-35-24-17-12-18-25-35)38(46-30-34-22-15-11-16-23-34)37(45-29-33-20-13-10-14-21-33)36(50-40)32-49-51(42,43)48-28-26-41(2,3)4/h10-18,20-25,36-40H,5-9,19,26-32H2,1-4H3/t36-,37+,38+,39-,40-/m1/s1 |
| InChIKey | ZRQYVQKOPMOQNM-IERCXCISSA-N |
| XLogP | 7.05 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.88 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|