About 3,4-diethoxythiophene
3,4-diethoxythiophene (PubChem CID 10997510) has the molecular formula C8H12O2S
and a molecular weight of 172.25 g/mol. Its IUPAC name is 3,4-diethoxythiophene.
Molecular Properties
| Compound Name | 3,4-diethoxythiophene |
| PubChem CID | 10997510 |
| Molecular Formula | C8H12O2S |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 3,4-diethoxythiophene |
| SMILES | CCOc1cscc1OCC |
| InChI | InChI=1S/C8H12O2S/c1-3-9-7-5-11-6-8(7)10-4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | MFRXQRCKOQUENC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-diethoxythiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethoxythiophene?
The IUPAC name of 3,4-diethoxythiophene (CID 10997510) is 3,4-diethoxythiophene.
What is the SMILES notation for 3,4-diethoxythiophene?
The canonical SMILES for 3,4-diethoxythiophene is CCOc1cscc1OCC.
What is the InChIKey of 3,4-diethoxythiophene?
The InChIKey is MFRXQRCKOQUENC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2S/c1-3-9-7-5-11-6-8(7)10-4-2/h5-6H,3-4H2,1-2H3.
What are the key properties of 3,4-diethoxythiophene?
3,4-diethoxythiophene has a molecular weight of 172.25 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethoxythiophene is sourced from PubChem (CID 10997510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).