C8H12O2S — CID 10997510
3,4-diethoxythiophene (PubChem CID 10997510) has the molecular formula C8H12O2S and a molecular weight of 172.25 g/mol. Its IUPAC name is 3,4-diethoxythiophene.
| Compound Name | 3,4-diethoxythiophene |
|---|---|
| PubChem CID | 10997510 |
| Molecular Formula | C8H12O2S |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 3,4-diethoxythiophene |
| SMILES | CCOc1cscc1OCC |
| InChI | InChI=1S/C8H12O2S/c1-3-9-7-5-11-6-8(7)10-4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | MFRXQRCKOQUENC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |