C7H8O2S — CID 10558853
3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine (PubChem CID 10558853) has the molecular formula C7H8O2S and a molecular weight of 156.21 g/mol. Its IUPAC name is 3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine.
| Compound Name | 3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine |
|---|---|
| PubChem CID | 10558853 |
| Molecular Formula | C7H8O2S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | 3,4-dihydro-2H-thieno[3,4-b][1,4]dioxepine |
| SMILES | c1scc2c1OCCCO2 |
| InChI | InChI=1S/C7H8O2S/c1-2-8-6-4-10-5-7(6)9-3-1/h4-5H,1-3H2 |
| InChIKey | WNOOCRQGKGWSJE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |