C9H10Br2O2S — CID 59591622
3,3-bis(bromomethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine (PubChem CID 59591622) has the molecular formula C9H10Br2O2S and a molecular weight of 342.05 g/mol. Its IUPAC name is 3,3-bis(bromomethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine.
| Compound Name | 3,3-bis(bromomethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
|---|---|
| PubChem CID | 59591622 |
| Molecular Formula | C9H10Br2O2S |
| Molecular Weight | 342.05 g/mol |
| Exact Mass | 339.88 |
| IUPAC Name | 3,3-bis(bromomethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
| SMILES | BrCC1(CBr)COc2cscc2OC1 |
| InChI | InChI=1S/C9H10Br2O2S/c10-3-9(4-11)5-12-7-1-14-2-8(7)13-6-9/h1-2H,3-6H2 |
| InChIKey | JSDPDQPADLMIHM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.05 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|