C15H18O2 — CID 10998815
(1S,8R)-4-ethyl-6-methoxytricyclo[6.2.2.02,7]dodeca-2,4,6,9-tetraen-3-ol (PubChem CID 10998815) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (1S,8R)-4-ethyl-6-methoxytricyclo[6.2.2.02,7]dodeca-2,4,6,9-tetraen-3-ol.
| Compound Name | (1S,8R)-4-ethyl-6-methoxytricyclo[6.2.2.02,7]dodeca-2,4,6,9-tetraen-3-ol |
|---|---|
| PubChem CID | 10998815 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (1S,8R)-4-ethyl-6-methoxytricyclo[6.2.2.02,7]dodeca-2,4,6,9-tetraen-3-ol |
| SMILES | CCc1cc(OC)c2c(c1O)[C@@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C15H18O2/c1-3-9-8-12(17-2)13-10-4-6-11(7-5-10)14(13)15(9)16/h4,6,8,10-11,16H,3,5,7H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | FZEXDMDQLBLWEN-WDEREUQCSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|