C9H18F3NO2Si — CID 10999712
N-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropropan-2-imine oxide (PubChem CID 10999712) has the molecular formula C9H18F3NO2Si and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropropan-2-imine oxide.
| Compound Name | N-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropropan-2-imine oxide |
|---|---|
| PubChem CID | 10999712 |
| Molecular Formula | C9H18F3NO2Si |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropropan-2-imine oxide |
| SMILES | C/C(=[N+](/[O-])O[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H18F3NO2Si/c1-7(9(10,11)12)13(14)15-16(5,6)8(2,3)4/h1-6H3/b13-7+ |
| InChIKey | IWTKIZQCPIXRFE-NTUHNPAUSA-N |
| XLogP | 3.46 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|