C14H11N3O2S — CID 11000607
3-(benzenesulfonyl)-1-phenyl-1,2,4-triazole (PubChem CID 11000607) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-phenyl-1,2,4-triazole.
| Compound Name | 3-(benzenesulfonyl)-1-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 11000607 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-(benzenesulfonyl)-1-phenyl-1,2,4-triazole |
| SMILES | O=S(=O)(c1ccccc1)c1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H11N3O2S/c18-20(19,13-9-5-2-6-10-13)14-15-11-17(16-14)12-7-3-1-4-8-12/h1-11H |
| InChIKey | DEGSYHRQOBKVMH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |