C19H24F2O3 — CID 11002232
(8S,9S,11S,13S,14S,16R,17R)-16-(18F)fluoro-4-fluoro-11-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 11002232) has the molecular formula C19H24F2O3 and a molecular weight of 337.40 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,16R,17R)-16-(18F)fluoro-4-fluoro-11-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9S,11S,13S,14S,16R,17R)-16-(18F)fluoro-4-fluoro-11-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 11002232 |
| Molecular Formula | C19H24F2O3 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (8S,9S,11S,13S,14S,16R,17R)-16-(18F)fluoro-4-fluoro-11-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CO[C@H]1C[C@]2(C)[C@@H](O)[C@H]([18F])C[C@H]2[C@@H]2CCc3c(ccc(O)c3F)[C@H]21 |
| InChI | InChI=1S/C19H24F2O3/c1-19-8-15(24-2)16-9-5-6-14(22)17(21)10(9)3-4-11(16)12(19)7-13(20)18(19)23/h5-6,11-13,15-16,18,22-23H,3-4,7-8H2,1-2H3/t11-,12-,13+,15-,16+,18-,19-/m0/s1/i20-1 |
| InChIKey | GWLRWTGQFYMBFK-MIVGZLAJSA-N |
| XLogP | 3.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |