C19H22BrFO3 — CID 10250182
(8S,9S,11S,13S,14S,16S)-16-bromo-4-fluoro-3-hydroxy-11-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 10250182) has the molecular formula C19H22BrFO3 and a molecular weight of 397.28 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,16S)-16-bromo-4-fluoro-3-hydroxy-11-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8S,9S,11S,13S,14S,16S)-16-bromo-4-fluoro-3-hydroxy-11-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 10250182 |
| Molecular Formula | C19H22BrFO3 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (8S,9S,11S,13S,14S,16S)-16-bromo-4-fluoro-3-hydroxy-11-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CO[C@H]1C[C@]2(C)C(=O)[C@@H](Br)C[C@H]2[C@@H]2CCc3c(ccc(O)c3F)[C@H]21 |
| InChI | InChI=1S/C19H22BrFO3/c1-19-8-15(24-2)16-9-5-6-14(22)17(21)10(9)3-4-11(16)12(19)7-13(20)18(19)23/h5-6,11-13,15-16,22H,3-4,7-8H2,1-2H3/t11-,12-,13-,15-,16+,19-/m0/s1 |
| InChIKey | LYFCQVCUUAFTFI-UDKKJPAVSA-N |
| XLogP | 3.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|