C19H23BrO — CID 154301910
(8R,9S,13S,14S,16R)-16-bromo-4,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 154301910) has the molecular formula C19H23BrO and a molecular weight of 347.30 g/mol. Its IUPAC name is (8R,9S,13S,14S,16R)-16-bromo-4,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S,16R)-16-bromo-4,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 154301910 |
| Molecular Formula | C19H23BrO |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (8R,9S,13S,14S,16R)-16-bromo-4,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | Cc1cccc2c1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)[C@H](Br)C[C@@H]12 |
| InChI | InChI=1S/C19H23BrO/c1-11-4-3-5-13-12(11)6-7-15-14(13)8-9-19(2)16(15)10-17(20)18(19)21/h3-5,14-17H,6-10H2,1-2H3/t14-,15-,16+,17-,19+/m1/s1 |
| InChIKey | UXAZCDHCCQWVTH-ILYVXUQDSA-N |
| XLogP | 4.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|