C21H24F5IN4O — CID 110037952
2-[[N-[1-(2,4-difluorophenyl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110037952) has the molecular formula C21H24F5IN4O and a molecular weight of 570.34 g/mol. Its IUPAC name is 2-[[N-[1-(2,4-difluorophenyl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-[1-(2,4-difluorophenyl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110037952 |
| Molecular Formula | C21H24F5IN4O |
| Molecular Weight | 570.34 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | 2-[[N-[1-(2,4-difluorophenyl)ethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CC(N/C(=N/Cc1cccc(C(F)(F)F)c1)NCC(=O)N(C)C)c1ccc(F)cc1F.I |
| InChI | InChI=1S/C21H23F5N4O.HI/c1-13(17-8-7-16(22)10-18(17)23)29-20(28-12-19(31)30(2)3)27-11-14-5-4-6-15(9-14)21(24,25)26;/h4-10,13H,11-12H2,1-3H3,(H2,27,28,29);1H |
| InChIKey | GGIXYSBDAGTKJG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|