C20H37O9P — CID 11004905
[(3aS,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] octyl hydrogen phosphate (PubChem CID 11004905) has the molecular formula C20H37O9P and a molecular weight of 452.48 g/mol. Its IUPAC name is [(3aS,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] octyl hydrogen phosphate.
| Compound Name | [(3aS,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] octyl hydrogen phosphate |
|---|---|
| PubChem CID | 11004905 |
| Molecular Formula | C20H37O9P |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | [(3aS,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] octyl hydrogen phosphate |
| SMILES | CCCCCCCCOP(=O)(O)O[C@@H]1[C@H]2OC(C)(C)O[C@@H]2O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H37O9P/c1-6-7-8-9-10-11-12-24-30(21,22)29-16-15(14-13-23-19(2,3)26-14)25-18-17(16)27-20(4,5)28-18/h14-18H,6-13H2,1-5H3,(H,21,22)/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | NWGIROMXGCBXKU-SFFUCWETSA-N |
| XLogP | 3.88 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|