C22H33IN4O3S — CID 110051281
tert-butyl N-[1-cyclopropyl-2-[[N-[2-(furan-2-yl)ethyl]-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 110051281) has the molecular formula C22H33IN4O3S and a molecular weight of 560.50 g/mol. Its IUPAC name is tert-butyl N-[1-cyclopropyl-2-[[N-[2-(furan-2-yl)ethyl]-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-cyclopropyl-2-[[N-[2-(furan-2-yl)ethyl]-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110051281 |
| Molecular Formula | C22H33IN4O3S |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | tert-butyl N-[1-cyclopropyl-2-[[N-[2-(furan-2-yl)ethyl]-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)NC(CN/C(=N/Cc1cccs1)NCCc1ccco1)C1CC1.I |
| InChI | InChI=1S/C22H32N4O3S.HI/c1-22(2,3)29-21(27)26-19(16-8-9-16)15-25-20(24-14-18-7-5-13-30-18)23-11-10-17-6-4-12-28-17;/h4-7,12-13,16,19H,8-11,14-15H2,1-3H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | AXRYNGNKIVWNBN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|