C25H28O9 — CID 11005204
dimethyl (1R,2S,6R,7S,14S,17R,19R)-17-acetyloxy-3,5-dioxo-4-oxapentacyclo[11.7.0.02,6.07,12.014,19]icosa-12,15-diene-20,20-dicarboxylate (PubChem CID 11005204) has the molecular formula C25H28O9 and a molecular weight of 472.49 g/mol. Its IUPAC name is dimethyl (1R,2S,6R,7S,14S,17R,19R)-17-acetyloxy-3,5-dioxo-4-oxapentacyclo[11.7.0.02,6.07,12.014,19]icosa-12,15-diene-20,20-dicarboxylate.
| Compound Name | dimethyl (1R,2S,6R,7S,14S,17R,19R)-17-acetyloxy-3,5-dioxo-4-oxapentacyclo[11.7.0.02,6.07,12.014,19]icosa-12,15-diene-20,20-dicarboxylate |
|---|---|
| PubChem CID | 11005204 |
| Molecular Formula | C25H28O9 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | dimethyl (1R,2S,6R,7S,14S,17R,19R)-17-acetyloxy-3,5-dioxo-4-oxapentacyclo[11.7.0.02,6.07,12.014,19]icosa-12,15-diene-20,20-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H]2C[C@@H](OC(C)=O)C=C[C@@H]2C2=C3CCCC[C@H]3[C@H]3C(=O)OC(=O)[C@H]3[C@H]21 |
| InChI | InChI=1S/C25H28O9/c1-11(26)33-12-8-9-15-16(10-12)25(23(29)31-2,24(30)32-3)20-17(15)13-6-4-5-7-14(13)18-19(20)22(28)34-21(18)27/h8-9,12,14-16,18-20H,4-7,10H2,1-3H3/t12-,14+,15-,16+,18+,19+,20-/m0/s1 |
| InChIKey | LPSWQXQTAVYUIK-RMYYIKJGSA-N |
| XLogP | 1.89 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|