C19H25BO4 — CID 124896398
(1S,2S,3R,7S,8R,16R)-18-methoxy-5-oxa-18-borapentacyclo[14.3.1.02,14.03,7.08,13]icos-13-ene-4,6-dione (PubChem CID 124896398) has the molecular formula C19H25BO4 and a molecular weight of 328.22 g/mol. Its IUPAC name is (1S,2S,3R,7S,8R,16R)-18-methoxy-5-oxa-18-borapentacyclo[14.3.1.02,14.03,7.08,13]icos-13-ene-4,6-dione.
| Compound Name | (1S,2S,3R,7S,8R,16R)-18-methoxy-5-oxa-18-borapentacyclo[14.3.1.02,14.03,7.08,13]icos-13-ene-4,6-dione |
|---|---|
| PubChem CID | 124896398 |
| Molecular Formula | C19H25BO4 |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (1S,2S,3R,7S,8R,16R)-18-methoxy-5-oxa-18-borapentacyclo[14.3.1.02,14.03,7.08,13]icos-13-ene-4,6-dione |
| SMILES | COB1C[C@H]2CC3=C4CCCC[C@@H]4[C@@H]4C(=O)OC(=O)[C@@H]4[C@@H]3[C@@H](C1)C2 |
| InChI | InChI=1S/C19H25BO4/c1-23-20-8-10-6-11(9-20)15-14(7-10)12-4-2-3-5-13(12)16-17(15)19(22)24-18(16)21/h10-11,13,15-17H,2-9H2,1H3/t10-,11-,13+,15-,16+,17-/m1/s1 |
| InChIKey | ROKKFFSXDVDAEI-INCJGEJSSA-N |
| XLogP | 3.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|