C9H17BO — CID 140592134
2-methoxy-1,3,3a,4,5,6,7,7a-octahydrobenzo[c]borole (PubChem CID 140592134) has the molecular formula C9H17BO and a molecular weight of 152.05 g/mol. Its IUPAC name is 2-methoxy-1,3,3a,4,5,6,7,7a-octahydrobenzo[c]borole.
| Compound Name | 2-methoxy-1,3,3a,4,5,6,7,7a-octahydrobenzo[c]borole |
|---|---|
| PubChem CID | 140592134 |
| Molecular Formula | C9H17BO |
| Molecular Weight | 152.05 g/mol |
| Exact Mass | 152.14 |
| IUPAC Name | 2-methoxy-1,3,3a,4,5,6,7,7a-octahydrobenzo[c]borole |
| SMILES | COB1CC2CCCCC2C1 |
| InChI | InChI=1S/C9H17BO/c1-11-10-6-8-4-2-3-5-9(8)7-10/h8-9H,2-7H2,1H3 |
| InChIKey | NLRVUBZGAHZZGN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.05 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|