C18H24O6 — CID 11099788
dimethyl (3aS,6R,7aR)-6-acetyloxy-3-(2-deuteriopropan-2-yl)-3a,6,7,7a-tetrahydroindene-1,1-dicarboxylate (PubChem CID 11099788) has the molecular formula C18H24O6 and a molecular weight of 337.39 g/mol. Its IUPAC name is dimethyl (3aS,6R,7aR)-6-acetyloxy-3-(2-deuteriopropan-2-yl)-3a,6,7,7a-tetrahydroindene-1,1-dicarboxylate.
| Compound Name | dimethyl (3aS,6R,7aR)-6-acetyloxy-3-(2-deuteriopropan-2-yl)-3a,6,7,7a-tetrahydroindene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11099788 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | dimethyl (3aS,6R,7aR)-6-acetyloxy-3-(2-deuteriopropan-2-yl)-3a,6,7,7a-tetrahydroindene-1,1-dicarboxylate |
| SMILES | [2H]C(C)(C)C1=CC(C(=O)OC)(C(=O)OC)[C@@H]2C[C@@H](OC(C)=O)C=C[C@H]12 |
| InChI | InChI=1S/C18H24O6/c1-10(2)14-9-18(16(20)22-4,17(21)23-5)15-8-12(24-11(3)19)6-7-13(14)15/h6-7,9-10,12-13,15H,8H2,1-5H3/t12-,13+,15+/m0/s1/i10D |
| InChIKey | VFUUVUKZWJYLGF-RPDDGROPSA-N |
| XLogP | 2.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|