C17H22O5 — CID 24745854
dimethyl (3aR,6S,8aR)-6-hydroxy-3-prop-1-en-2-yl-6,7,8,8a-tetrahydro-3aH-azulene-1,1-dicarboxylate (PubChem CID 24745854) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is dimethyl (3aR,6S,8aR)-6-hydroxy-3-prop-1-en-2-yl-6,7,8,8a-tetrahydro-3aH-azulene-1,1-dicarboxylate.
| Compound Name | dimethyl (3aR,6S,8aR)-6-hydroxy-3-prop-1-en-2-yl-6,7,8,8a-tetrahydro-3aH-azulene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 24745854 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | dimethyl (3aR,6S,8aR)-6-hydroxy-3-prop-1-en-2-yl-6,7,8,8a-tetrahydro-3aH-azulene-1,1-dicarboxylate |
| SMILES | C=C(C)C1=CC(C(=O)OC)(C(=O)OC)[C@@H]2CC[C@H](O)C=C[C@@H]12 |
| InChI | InChI=1S/C17H22O5/c1-10(2)13-9-17(15(19)21-3,16(20)22-4)14-8-6-11(18)5-7-12(13)14/h5,7,9,11-12,14,18H,1,6,8H2,2-4H3/t11-,12+,14-/m1/s1 |
| InChIKey | YINKTPIGJVHVCS-MBNYWOFBSA-N |
| XLogP | 1.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|