C18H24O5 — CID 101446426
dimethyl (3aS,6R,7aR)-6-hydroxy-3-(3-methylbut-2-en-2-yl)-3a,6,7,7a-tetrahydroindene-1,1-dicarboxylate (PubChem CID 101446426) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is dimethyl (3aS,6R,7aR)-6-hydroxy-3-(3-methylbut-2-en-2-yl)-3a,6,7,7a-tetrahydroindene-1,1-dicarboxylate.
| Compound Name | dimethyl (3aS,6R,7aR)-6-hydroxy-3-(3-methylbut-2-en-2-yl)-3a,6,7,7a-tetrahydroindene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101446426 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | dimethyl (3aS,6R,7aR)-6-hydroxy-3-(3-methylbut-2-en-2-yl)-3a,6,7,7a-tetrahydroindene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C(C(C)=C(C)C)[C@H]2C=C[C@H](O)C[C@H]21 |
| InChI | InChI=1S/C18H24O5/c1-10(2)11(3)14-9-18(16(20)22-4,17(21)23-5)15-8-12(19)6-7-13(14)15/h6-7,9,12-13,15,19H,8H2,1-5H3/t12-,13+,15+/m0/s1 |
| InChIKey | HYXCBCMGXGPLMJ-GZBFAFLISA-N |
| XLogP | 2.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|