C19H34ClN5O3SSi — CID 11005280
tert-butyl N-[5-[(1R,2S)-3-azido-2-chloro-1-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypropyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 11005280) has the molecular formula C19H34ClN5O3SSi and a molecular weight of 476.12 g/mol. Its IUPAC name is tert-butyl N-[5-[(1R,2S)-3-azido-2-chloro-1-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypropyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-[(1R,2S)-3-azido-2-chloro-1-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypropyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 11005280 |
| Molecular Formula | C19H34ClN5O3SSi |
| Molecular Weight | 476.12 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | tert-butyl N-[5-[(1R,2S)-3-azido-2-chloro-1-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypropyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)C(C)(C)[Si](C)(C)O[C@H](c1cnc(NC(=O)OC(C)(C)C)s1)[C@@H](Cl)CN=[N+]=[N-] |
| InChI | InChI=1S/C19H34ClN5O3SSi/c1-12(2)19(6,7)30(8,9)28-15(13(20)10-23-25-21)14-11-22-16(29-14)24-17(26)27-18(3,4)5/h11-13,15H,10H2,1-9H3,(H,22,24,26)/t13-,15-/m0/s1 |
| InChIKey | CLLBEERZHLUADL-ZFWWWQNUSA-N |
| XLogP | 7.11 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.12 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|