C26H32N2O3 — CID 110064325
15-(3-cyclobutylpropanoyl)-3-methyl-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one (PubChem CID 110064325) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is 15-(3-cyclobutylpropanoyl)-3-methyl-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one.
| Compound Name | 15-(3-cyclobutylpropanoyl)-3-methyl-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one |
|---|---|
| PubChem CID | 110064325 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 15-(3-cyclobutylpropanoyl)-3-methyl-11-oxa-3,15-diazatricyclo[15.3.1.05,10]henicosa-1(21),5,7,9,17,19-hexaen-4-one |
| SMILES | CN1Cc2cccc(c2)CN(C(=O)CCC2CCC2)CCCOc2ccccc2C1=O |
| InChI | InChI=1S/C26H32N2O3/c1-27-18-21-9-5-10-22(17-21)19-28(25(29)14-13-20-7-4-8-20)15-6-16-31-24-12-3-2-11-23(24)26(27)30/h2-3,5,9-12,17,20H,4,6-8,13-16,18-19H2,1H3 |
| InChIKey | OXWNJZNINAENRH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |