C35H38O7SSi — CID 11006714
(5R,6S)-4-(benzenesulfonyl)-6-[(1S,2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-phenylethyl]-5-hydroxyoxan-2-one (PubChem CID 11006714) has the molecular formula C35H38O7SSi and a molecular weight of 630.84 g/mol. Its IUPAC name is (5R,6S)-4-(benzenesulfonyl)-6-[(1S,2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-phenylethyl]-5-hydroxyoxan-2-one.
| Compound Name | (5R,6S)-4-(benzenesulfonyl)-6-[(1S,2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-phenylethyl]-5-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 11006714 |
| Molecular Formula | C35H38O7SSi |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | (5R,6S)-4-(benzenesulfonyl)-6-[(1S,2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-phenylethyl]-5-hydroxyoxan-2-one |
| SMILES | CC(C)(C)[Si](O[C@@H](c1ccccc1)[C@@H](O)[C@@H]1OC(=O)CC(S(=O)(=O)c2ccccc2)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H38O7SSi/c1-35(2,3)44(27-20-12-6-13-21-27,28-22-14-7-15-23-28)42-33(25-16-8-4-9-17-25)32(38)34-31(37)29(24-30(36)41-34)43(39,40)26-18-10-5-11-19-26/h4-23,29,31-34,37-38H,24H2,1-3H3/t29?,31-,32+,33-,34+/m0/s1 |
| InChIKey | WPXYDAGTQBUBCW-ISDIUBGBSA-N |
| XLogP | 4.18 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|