C35H38O6SSi — CID 71763635
[(2R,3R,4S,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-dihydroxy-6-phenylsulfanyloxan-4-yl] benzoate (PubChem CID 71763635) has the molecular formula C35H38O6SSi and a molecular weight of 614.84 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-dihydroxy-6-phenylsulfanyloxan-4-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-dihydroxy-6-phenylsulfanyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 71763635 |
| Molecular Formula | C35H38O6SSi |
| Molecular Weight | 614.84 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-dihydroxy-6-phenylsulfanyloxan-4-yl] benzoate |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](Sc2ccccc2)[C@@H](O)[C@@H](OC(=O)c2ccccc2)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H38O6SSi/c1-35(2,3)43(27-20-12-6-13-21-27,28-22-14-7-15-23-28)39-24-29-30(36)32(41-33(38)25-16-8-4-9-17-25)31(37)34(40-29)42-26-18-10-5-11-19-26/h4-23,29-32,34,36-37H,24H2,1-3H3/t29-,30-,31+,32+,34+/m1/s1 |
| InChIKey | MBPNJIZHTKNOTA-KWXXMMNJSA-N |
| XLogP | 5.03 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.84 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|