C38H42O6SSi — CID 11377282
[(2R,3S,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-6-phenylsulfanyl-4-prop-2-enoxyoxan-3-yl] benzoate (PubChem CID 11377282) has the molecular formula C38H42O6SSi and a molecular weight of 654.90 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-6-phenylsulfanyl-4-prop-2-enoxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-6-phenylsulfanyl-4-prop-2-enoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11377282 |
| Molecular Formula | C38H42O6SSi |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-6-phenylsulfanyl-4-prop-2-enoxyoxan-3-yl] benzoate |
| SMILES | C=CCO[C@@H]1[C@@H](O)[C@H](Sc2ccccc2)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H42O6SSi/c1-5-26-41-35-33(39)37(45-29-20-12-7-13-21-29)43-32(34(35)44-36(40)28-18-10-6-11-19-28)27-42-46(38(2,3)4,30-22-14-8-15-23-30)31-24-16-9-17-25-31/h5-25,32-35,37,39H,1,26-27H2,2-4H3/t32-,33-,34+,35-,37+/m1/s1 |
| InChIKey | TVWHOMIMRMNTFJ-KKOKAIPGSA-N |
| XLogP | 6.24 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.90 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|