About lithium 3-methylbut-1-yne
lithium 3-methylbut-1-yne (PubChem CID 11007814) has the molecular formula C5H7Li
and a molecular weight of 74.05 g/mol. Its IUPAC name is lithium 3-methylbut-1-yne.
Molecular Properties
| Compound Name | lithium 3-methylbut-1-yne |
| PubChem CID | 11007814 |
| Molecular Formula | C5H7Li |
| Molecular Weight | 74.05 g/mol |
| Exact Mass | 74.07 |
| IUPAC Name | lithium 3-methylbut-1-yne |
| SMILES | [C-]#CC(C)C.[Li+] |
| InChI | InChI=1S/C5H7.Li/c1-4-5(2)3;/h5H,2-3H3;/q-1;+1 |
| InChIKey | SXWJGBGPDCSAII-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 74.05 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze lithium 3-methylbut-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 3-methylbut-1-yne?
The IUPAC name of lithium 3-methylbut-1-yne (CID 11007814) is lithium 3-methylbut-1-yne.
What is the SMILES notation for lithium 3-methylbut-1-yne?
The canonical SMILES for lithium 3-methylbut-1-yne is [C-]#CC(C)C.[Li+].
What is the InChIKey of lithium 3-methylbut-1-yne?
The InChIKey is SXWJGBGPDCSAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7.Li/c1-4-5(2)3;/h5H,2-3H3;/q-1;+1.
What are the key properties of lithium 3-methylbut-1-yne?
lithium 3-methylbut-1-yne has a molecular weight of 74.05 g/mol, XLogP of -1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 3-methylbut-1-yne is sourced from PubChem (CID 11007814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).